C24H24FNO6 — CID 36831722
[2-methoxy-4-[(E)-3-methoxy-3-oxoprop-1-enyl]phenyl] 1-(4-fluorobenzoyl)piperidine-4-carboxylate (PubChem CID 36831722) has the molecular formula C24H24FNO6 and a molecular weight of 441.46 g/mol. Its IUPAC name is [2-methoxy-4-[(E)-3-methoxy-3-oxoprop-1-enyl]phenyl] 1-(4-fluorobenzoyl)piperidine-4-carboxylate.
| Compound Name | [2-methoxy-4-[(E)-3-methoxy-3-oxoprop-1-enyl]phenyl] 1-(4-fluorobenzoyl)piperidine-4-carboxylate |
|---|---|
| PubChem CID | 36831722 |
| Molecular Formula | C24H24FNO6 |
| Molecular Weight | 441.46 g/mol |
| Exact Mass | 441.16 |
| IUPAC Name | [2-methoxy-4-[(E)-3-methoxy-3-oxoprop-1-enyl]phenyl] 1-(4-fluorobenzoyl)piperidine-4-carboxylate |
| SMILES | COC(=O)/C=C/c1ccc(OC(=O)C2CCN(C(=O)c3ccc(F)cc3)CC2)c(OC)c1 |
| InChI | InChI=1S/C24H24FNO6/c1-30-21-15-16(4-10-22(27)31-2)3-9-20(21)32-24(29)18-11-13-26(14-12-18)23(28)17-5-7-19(25)8-6-17/h3-10,15,18H,11-14H2,1-2H3/b10-4+ |
| InChIKey | VQBOHGLSUUTKJO-ONNFQVAWSA-N |
| XLogP | 3.48 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.46 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|