C27H33NO6 — CID 55531145
[2-methoxy-4-[(E)-3-methoxy-3-oxoprop-1-enyl]phenyl] 1-(adamantane-1-carbonyl)pyrrolidine-2-carboxylate (PubChem CID 55531145) has the molecular formula C27H33NO6 and a molecular weight of 467.56 g/mol. Its IUPAC name is [2-methoxy-4-[(E)-3-methoxy-3-oxoprop-1-enyl]phenyl] 1-(adamantane-1-carbonyl)pyrrolidine-2-carboxylate.
| Compound Name | [2-methoxy-4-[(E)-3-methoxy-3-oxoprop-1-enyl]phenyl] 1-(adamantane-1-carbonyl)pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 55531145 |
| Molecular Formula | C27H33NO6 |
| Molecular Weight | 467.56 g/mol |
| Exact Mass | 467.23 |
| IUPAC Name | [2-methoxy-4-[(E)-3-methoxy-3-oxoprop-1-enyl]phenyl] 1-(adamantane-1-carbonyl)pyrrolidine-2-carboxylate |
| SMILES | COC(=O)/C=C/c1ccc(OC(=O)C2CCCN2C(=O)C23CC4CC(CC(C4)C2)C3)c(OC)c1 |
| InChI | InChI=1S/C27H33NO6/c1-32-23-13-17(6-8-24(29)33-2)5-7-22(23)34-25(30)21-4-3-9-28(21)26(31)27-14-18-10-19(15-27)12-20(11-18)16-27/h5-8,13,18-21H,3-4,9-12,14-16H2,1-2H3/b8-6+ |
| InChIKey | ANMWNTRUZJIQOO-SOFGYWHQSA-N |
| XLogP | 3.99 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.56 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|