C23H25NO7S — CID 55534413
[2-methoxy-4-[(E)-3-methoxy-3-oxoprop-1-enyl]phenyl] 1-(benzenesulfonyl)piperidine-2-carboxylate (PubChem CID 55534413) has the molecular formula C23H25NO7S and a molecular weight of 459.52 g/mol. Its IUPAC name is [2-methoxy-4-[(E)-3-methoxy-3-oxoprop-1-enyl]phenyl] 1-(benzenesulfonyl)piperidine-2-carboxylate.
| Compound Name | [2-methoxy-4-[(E)-3-methoxy-3-oxoprop-1-enyl]phenyl] 1-(benzenesulfonyl)piperidine-2-carboxylate |
|---|---|
| PubChem CID | 55534413 |
| Molecular Formula | C23H25NO7S |
| Molecular Weight | 459.52 g/mol |
| Exact Mass | 459.14 |
| IUPAC Name | [2-methoxy-4-[(E)-3-methoxy-3-oxoprop-1-enyl]phenyl] 1-(benzenesulfonyl)piperidine-2-carboxylate |
| SMILES | COC(=O)/C=C/c1ccc(OC(=O)C2CCCCN2S(=O)(=O)c2ccccc2)c(OC)c1 |
| InChI | InChI=1S/C23H25NO7S/c1-29-21-16-17(12-14-22(25)30-2)11-13-20(21)31-23(26)19-10-6-7-15-24(19)32(27,28)18-8-4-3-5-9-18/h3-5,8-9,11-14,16,19H,6-7,10,15H2,1-2H3/b14-12+ |
| InChIKey | RLKCCEYTKVQNME-WYMLVPIESA-N |
| XLogP | 3.03 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.52 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|