C24H27NO8S — CID 24651961
[2-methoxy-4-[(E)-3-methoxy-3-oxoprop-1-enyl]phenyl] 1-(4-methoxyphenyl)sulfonylpiperidine-3-carboxylate (PubChem CID 24651961) has the molecular formula C24H27NO8S and a molecular weight of 489.55 g/mol. Its IUPAC name is [2-methoxy-4-[(E)-3-methoxy-3-oxoprop-1-enyl]phenyl] 1-(4-methoxyphenyl)sulfonylpiperidine-3-carboxylate.
| Compound Name | [2-methoxy-4-[(E)-3-methoxy-3-oxoprop-1-enyl]phenyl] 1-(4-methoxyphenyl)sulfonylpiperidine-3-carboxylate |
|---|---|
| PubChem CID | 24651961 |
| Molecular Formula | C24H27NO8S |
| Molecular Weight | 489.55 g/mol |
| Exact Mass | 489.15 |
| IUPAC Name | [2-methoxy-4-[(E)-3-methoxy-3-oxoprop-1-enyl]phenyl] 1-(4-methoxyphenyl)sulfonylpiperidine-3-carboxylate |
| SMILES | COC(=O)/C=C/c1ccc(OC(=O)C2CCCN(S(=O)(=O)c3ccc(OC)cc3)C2)c(OC)c1 |
| InChI | InChI=1S/C24H27NO8S/c1-30-19-8-10-20(11-9-19)34(28,29)25-14-4-5-18(16-25)24(27)33-21-12-6-17(15-22(21)31-2)7-13-23(26)32-3/h6-13,15,18H,4-5,14,16H2,1-3H3/b13-7+ |
| InChIKey | RRERGFRWJGNZKB-NTUHNPAUSA-N |
| XLogP | 2.90 |
| TPSA | 108.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.55 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|