C23H20ClN3O5S — CID 3255790
[4-(2,2-dicyanoethenyl)-2-methoxyphenyl] 1-(4-chlorophenyl)sulfonylpiperidine-3-carboxylate (PubChem CID 3255790) has the molecular formula C23H20ClN3O5S and a molecular weight of 485.95 g/mol. Its IUPAC name is [4-(2,2-dicyanoethenyl)-2-methoxyphenyl] 1-(4-chlorophenyl)sulfonylpiperidine-3-carboxylate.
| Compound Name | [4-(2,2-dicyanoethenyl)-2-methoxyphenyl] 1-(4-chlorophenyl)sulfonylpiperidine-3-carboxylate |
|---|---|
| PubChem CID | 3255790 |
| Molecular Formula | C23H20ClN3O5S |
| Molecular Weight | 485.95 g/mol |
| Exact Mass | 485.08 |
| IUPAC Name | [4-(2,2-dicyanoethenyl)-2-methoxyphenyl] 1-(4-chlorophenyl)sulfonylpiperidine-3-carboxylate |
| SMILES | COc1cc(C=C(C#N)C#N)ccc1OC(=O)C1CCCN(S(=O)(=O)c2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C23H20ClN3O5S/c1-31-22-12-16(11-17(13-25)14-26)4-9-21(22)32-23(28)18-3-2-10-27(15-18)33(29,30)20-7-5-19(24)6-8-20/h4-9,11-12,18H,2-3,10,15H2,1H3 |
| InChIKey | DMQOPHFVQOKUFP-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 120.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.95 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|