C24H22N4O5S — CID 3250994
[4-(2,2-dicyanoethenyl)phenyl] 1-(4-acetamidophenyl)sulfonylpiperidine-3-carboxylate (PubChem CID 3250994) has the molecular formula C24H22N4O5S and a molecular weight of 478.53 g/mol. Its IUPAC name is [4-(2,2-dicyanoethenyl)phenyl] 1-(4-acetamidophenyl)sulfonylpiperidine-3-carboxylate.
| Compound Name | [4-(2,2-dicyanoethenyl)phenyl] 1-(4-acetamidophenyl)sulfonylpiperidine-3-carboxylate |
|---|---|
| PubChem CID | 3250994 |
| Molecular Formula | C24H22N4O5S |
| Molecular Weight | 478.53 g/mol |
| Exact Mass | 478.13 |
| IUPAC Name | [4-(2,2-dicyanoethenyl)phenyl] 1-(4-acetamidophenyl)sulfonylpiperidine-3-carboxylate |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)N2CCCC(C(=O)Oc3ccc(C=C(C#N)C#N)cc3)C2)cc1 |
| InChI | InChI=1S/C24H22N4O5S/c1-17(29)27-21-6-10-23(11-7-21)34(31,32)28-12-2-3-20(16-28)24(30)33-22-8-4-18(5-9-22)13-19(14-25)15-26/h4-11,13,20H,2-3,12,16H2,1H3,(H,27,29) |
| InChIKey | MUZCEFSSVFTVGD-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 140.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.53 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|