C18H25N3O4S2 — CID 40900598
N-[4-[(3S)-3-(thiomorpholine-4-carbonyl)piperidin-1-yl]sulfonylphenyl]acetamide (PubChem CID 40900598) has the molecular formula C18H25N3O4S2 and a molecular weight of 411.55 g/mol. Its IUPAC name is N-[4-[(3S)-3-(thiomorpholine-4-carbonyl)piperidin-1-yl]sulfonylphenyl]acetamide.
| Compound Name | N-[4-[(3S)-3-(thiomorpholine-4-carbonyl)piperidin-1-yl]sulfonylphenyl]acetamide |
|---|---|
| PubChem CID | 40900598 |
| Molecular Formula | C18H25N3O4S2 |
| Molecular Weight | 411.55 g/mol |
| Exact Mass | 411.13 |
| IUPAC Name | N-[4-[(3S)-3-(thiomorpholine-4-carbonyl)piperidin-1-yl]sulfonylphenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)N2CCC[C@H](C(=O)N3CCSCC3)C2)cc1 |
| InChI | InChI=1S/C18H25N3O4S2/c1-14(22)19-16-4-6-17(7-5-16)27(24,25)21-8-2-3-15(13-21)18(23)20-9-11-26-12-10-20/h4-7,15H,2-3,8-13H2,1H3,(H,19,22)/t15-/m0/s1 |
| InChIKey | RFDWAADDSZYOTR-HNNXBMFYSA-N |
| XLogP | 1.62 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.55 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |