C20H29N3O6S2 — CID 16605464
morpholin-4-yl-[1-(4-pyrrolidin-1-ylsulfonylphenyl)sulfonylpiperidin-3-yl]methanone (PubChem CID 16605464) has the molecular formula C20H29N3O6S2 and a molecular weight of 471.60 g/mol. Its IUPAC name is morpholin-4-yl-[1-(4-pyrrolidin-1-ylsulfonylphenyl)sulfonylpiperidin-3-yl]methanone.
| Compound Name | morpholin-4-yl-[1-(4-pyrrolidin-1-ylsulfonylphenyl)sulfonylpiperidin-3-yl]methanone |
|---|---|
| PubChem CID | 16605464 |
| Molecular Formula | C20H29N3O6S2 |
| Molecular Weight | 471.60 g/mol |
| Exact Mass | 471.15 |
| IUPAC Name | morpholin-4-yl-[1-(4-pyrrolidin-1-ylsulfonylphenyl)sulfonylpiperidin-3-yl]methanone |
| SMILES | O=C(C1CCCN(S(=O)(=O)c2ccc(S(=O)(=O)N3CCCC3)cc2)C1)N1CCOCC1 |
| InChI | InChI=1S/C20H29N3O6S2/c24-20(21-12-14-29-15-13-21)17-4-3-11-23(16-17)31(27,28)19-7-5-18(6-8-19)30(25,26)22-9-1-2-10-22/h5-8,17H,1-4,9-16H2 |
| InChIKey | XLXCKRVAHXMMAS-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 104.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.60 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |