C16H20Cl2N2O4S — CID 24604852
[1-(3,5-dichlorophenyl)sulfonylpiperidin-3-yl]-morpholin-4-ylmethanone (PubChem CID 24604852) has the molecular formula C16H20Cl2N2O4S and a molecular weight of 407.32 g/mol. Its IUPAC name is [1-(3,5-dichlorophenyl)sulfonylpiperidin-3-yl]-morpholin-4-ylmethanone.
| Compound Name | [1-(3,5-dichlorophenyl)sulfonylpiperidin-3-yl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 24604852 |
| Molecular Formula | C16H20Cl2N2O4S |
| Molecular Weight | 407.32 g/mol |
| Exact Mass | 406.05 |
| IUPAC Name | [1-(3,5-dichlorophenyl)sulfonylpiperidin-3-yl]-morpholin-4-ylmethanone |
| SMILES | O=C(C1CCCN(S(=O)(=O)c2cc(Cl)cc(Cl)c2)C1)N1CCOCC1 |
| InChI | InChI=1S/C16H20Cl2N2O4S/c17-13-8-14(18)10-15(9-13)25(22,23)20-3-1-2-12(11-20)16(21)19-4-6-24-7-5-19/h8-10,12H,1-7,11H2 |
| InChIKey | BKRVDCOQPAPDLF-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.32 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |