C20H29N3O4S — CID 58656229
N-[(3S)-1-(4-acetamidophenyl)sulfonylpiperidin-3-yl]cyclohexanecarboxamide (PubChem CID 58656229) has the molecular formula C20H29N3O4S and a molecular weight of 407.54 g/mol. Its IUPAC name is N-[(3S)-1-(4-acetamidophenyl)sulfonylpiperidin-3-yl]cyclohexanecarboxamide.
| Compound Name | N-[(3S)-1-(4-acetamidophenyl)sulfonylpiperidin-3-yl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 58656229 |
| Molecular Formula | C20H29N3O4S |
| Molecular Weight | 407.54 g/mol |
| Exact Mass | 407.19 |
| IUPAC Name | N-[(3S)-1-(4-acetamidophenyl)sulfonylpiperidin-3-yl]cyclohexanecarboxamide |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)N2CCC[C@H](NC(=O)C3CCCCC3)C2)cc1 |
| InChI | InChI=1S/C20H29N3O4S/c1-15(24)21-17-9-11-19(12-10-17)28(26,27)23-13-5-8-18(14-23)22-20(25)16-6-3-2-4-7-16/h9-12,16,18H,2-8,13-14H2,1H3,(H,21,24)(H,22,25)/t18-/m0/s1 |
| InChIKey | QXWLZUPBCIGEBY-SFHVURJKSA-N |
| XLogP | 2.49 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.54 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |