C22H18ClN3O4S — CID 3258391
[4-(2,2-dicyanoethenyl)phenyl] 1-(4-chlorophenyl)sulfonylpiperidine-4-carboxylate (PubChem CID 3258391) has the molecular formula C22H18ClN3O4S and a molecular weight of 455.92 g/mol. Its IUPAC name is [4-(2,2-dicyanoethenyl)phenyl] 1-(4-chlorophenyl)sulfonylpiperidine-4-carboxylate.
| Compound Name | [4-(2,2-dicyanoethenyl)phenyl] 1-(4-chlorophenyl)sulfonylpiperidine-4-carboxylate |
|---|---|
| PubChem CID | 3258391 |
| Molecular Formula | C22H18ClN3O4S |
| Molecular Weight | 455.92 g/mol |
| Exact Mass | 455.07 |
| IUPAC Name | [4-(2,2-dicyanoethenyl)phenyl] 1-(4-chlorophenyl)sulfonylpiperidine-4-carboxylate |
| SMILES | N#CC(C#N)=Cc1ccc(OC(=O)C2CCN(S(=O)(=O)c3ccc(Cl)cc3)CC2)cc1 |
| InChI | InChI=1S/C22H18ClN3O4S/c23-19-3-7-21(8-4-19)31(28,29)26-11-9-18(10-12-26)22(27)30-20-5-1-16(2-6-20)13-17(14-24)15-25/h1-8,13,18H,9-12H2 |
| InChIKey | WZNTWFGEQKEJFX-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 111.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.92 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|