C20H20ClNO5S — CID 32759546
[4-(4-chlorobenzoyl)phenyl] 1-methylsulfonylpiperidine-4-carboxylate (PubChem CID 32759546) has the molecular formula C20H20ClNO5S and a molecular weight of 421.90 g/mol. Its IUPAC name is [4-(4-chlorobenzoyl)phenyl] 1-methylsulfonylpiperidine-4-carboxylate.
| Compound Name | [4-(4-chlorobenzoyl)phenyl] 1-methylsulfonylpiperidine-4-carboxylate |
|---|---|
| PubChem CID | 32759546 |
| Molecular Formula | C20H20ClNO5S |
| Molecular Weight | 421.90 g/mol |
| Exact Mass | 421.08 |
| IUPAC Name | [4-(4-chlorobenzoyl)phenyl] 1-methylsulfonylpiperidine-4-carboxylate |
| SMILES | CS(=O)(=O)N1CCC(C(=O)Oc2ccc(C(=O)c3ccc(Cl)cc3)cc2)CC1 |
| InChI | InChI=1S/C20H20ClNO5S/c1-28(25,26)22-12-10-16(11-13-22)20(24)27-18-8-4-15(5-9-18)19(23)14-2-6-17(21)7-3-14/h2-9,16H,10-13H2,1H3 |
| InChIKey | ZQYSOFJLFZBFBM-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.90 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|