C17H18ClNO4S — CID 24603293
(4-chloronaphthalen-1-yl) 1-methylsulfonylpiperidine-4-carboxylate (PubChem CID 24603293) has the molecular formula C17H18ClNO4S and a molecular weight of 367.85 g/mol. Its IUPAC name is (4-chloronaphthalen-1-yl) 1-methylsulfonylpiperidine-4-carboxylate.
| Compound Name | (4-chloronaphthalen-1-yl) 1-methylsulfonylpiperidine-4-carboxylate |
|---|---|
| PubChem CID | 24603293 |
| Molecular Formula | C17H18ClNO4S |
| Molecular Weight | 367.85 g/mol |
| Exact Mass | 367.06 |
| IUPAC Name | (4-chloronaphthalen-1-yl) 1-methylsulfonylpiperidine-4-carboxylate |
| SMILES | CS(=O)(=O)N1CCC(C(=O)Oc2ccc(Cl)c3ccccc23)CC1 |
| InChI | InChI=1S/C17H18ClNO4S/c1-24(21,22)19-10-8-12(9-11-19)17(20)23-16-7-6-15(18)13-4-2-3-5-14(13)16/h2-7,12H,8-11H2,1H3 |
| InChIKey | QCONXEYEEJRPKR-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.85 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|