C14H18ClNO4S — CID 134042885
(4-chloro-2-methylphenyl) 1-methylsulfonylpiperidine-3-carboxylate (PubChem CID 134042885) has the molecular formula C14H18ClNO4S and a molecular weight of 331.82 g/mol. Its IUPAC name is (4-chloro-2-methylphenyl) 1-methylsulfonylpiperidine-3-carboxylate.
| Compound Name | (4-chloro-2-methylphenyl) 1-methylsulfonylpiperidine-3-carboxylate |
|---|---|
| PubChem CID | 134042885 |
| Molecular Formula | C14H18ClNO4S |
| Molecular Weight | 331.82 g/mol |
| Exact Mass | 331.06 |
| IUPAC Name | (4-chloro-2-methylphenyl) 1-methylsulfonylpiperidine-3-carboxylate |
| SMILES | Cc1cc(Cl)ccc1OC(=O)C1CCCN(S(C)(=O)=O)C1 |
| InChI | InChI=1S/C14H18ClNO4S/c1-10-8-12(15)5-6-13(10)20-14(17)11-4-3-7-16(9-11)21(2,18)19/h5-6,8,11H,3-4,7,9H2,1-2H3 |
| InChIKey | CORPMDYXTIVQRT-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.82 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|