C20H23ClN2O6S2 — CID 43043816
[4-[(4-chlorophenyl)sulfonyl-methylamino]phenyl] 1-methylsulfonylpiperidine-3-carboxylate (PubChem CID 43043816) has the molecular formula C20H23ClN2O6S2 and a molecular weight of 487.00 g/mol. Its IUPAC name is [4-[(4-chlorophenyl)sulfonyl-methylamino]phenyl] 1-methylsulfonylpiperidine-3-carboxylate.
| Compound Name | [4-[(4-chlorophenyl)sulfonyl-methylamino]phenyl] 1-methylsulfonylpiperidine-3-carboxylate |
|---|---|
| PubChem CID | 43043816 |
| Molecular Formula | C20H23ClN2O6S2 |
| Molecular Weight | 487.00 g/mol |
| Exact Mass | 486.07 |
| IUPAC Name | [4-[(4-chlorophenyl)sulfonyl-methylamino]phenyl] 1-methylsulfonylpiperidine-3-carboxylate |
| SMILES | CN(c1ccc(OC(=O)C2CCCN(S(C)(=O)=O)C2)cc1)S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H23ClN2O6S2/c1-22(31(27,28)19-11-5-16(21)6-12-19)17-7-9-18(10-8-17)29-20(24)15-4-3-13-23(14-15)30(2,25)26/h5-12,15H,3-4,13-14H2,1-2H3 |
| InChIKey | DNYYYXJJZVHFLY-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 101.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.00 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|