C29H26ClN3O5S — CID 3258390
[4-[(3-methyl-5-oxo-1-phenylpyrazol-4-ylidene)methyl]phenyl] 1-(4-chlorophenyl)sulfonylpiperidine-3-carboxylate (PubChem CID 3258390) has the molecular formula C29H26ClN3O5S and a molecular weight of 564.06 g/mol. Its IUPAC name is [4-[(3-methyl-5-oxo-1-phenylpyrazol-4-ylidene)methyl]phenyl] 1-(4-chlorophenyl)sulfonylpiperidine-3-carboxylate.
| Compound Name | [4-[(3-methyl-5-oxo-1-phenylpyrazol-4-ylidene)methyl]phenyl] 1-(4-chlorophenyl)sulfonylpiperidine-3-carboxylate |
|---|---|
| PubChem CID | 3258390 |
| Molecular Formula | C29H26ClN3O5S |
| Molecular Weight | 564.06 g/mol |
| Exact Mass | 563.13 |
| IUPAC Name | [4-[(3-methyl-5-oxo-1-phenylpyrazol-4-ylidene)methyl]phenyl] 1-(4-chlorophenyl)sulfonylpiperidine-3-carboxylate |
| SMILES | CC1=NN(c2ccccc2)C(=O)C1=Cc1ccc(OC(=O)C2CCCN(S(=O)(=O)c3ccc(Cl)cc3)C2)cc1 |
| InChI | InChI=1S/C29H26ClN3O5S/c1-20-27(28(34)33(31-20)24-7-3-2-4-8-24)18-21-9-13-25(14-10-21)38-29(35)22-6-5-17-32(19-22)39(36,37)26-15-11-23(30)12-16-26/h2-4,7-16,18,22H,5-6,17,19H2,1H3 |
| InChIKey | AIBPFGSPXNQXLG-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 96.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.06 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|