C13H15BrClNO4S — CID 55556065
(2-bromo-4-chlorophenyl) 1-methylsulfonylpiperidine-3-carboxylate (PubChem CID 55556065) has the molecular formula C13H15BrClNO4S and a molecular weight of 396.69 g/mol. Its IUPAC name is (2-bromo-4-chlorophenyl) 1-methylsulfonylpiperidine-3-carboxylate.
| Compound Name | (2-bromo-4-chlorophenyl) 1-methylsulfonylpiperidine-3-carboxylate |
|---|---|
| PubChem CID | 55556065 |
| Molecular Formula | C13H15BrClNO4S |
| Molecular Weight | 396.69 g/mol |
| Exact Mass | 394.96 |
| IUPAC Name | (2-bromo-4-chlorophenyl) 1-methylsulfonylpiperidine-3-carboxylate |
| SMILES | CS(=O)(=O)N1CCCC(C(=O)Oc2ccc(Cl)cc2Br)C1 |
| InChI | InChI=1S/C13H15BrClNO4S/c1-21(18,19)16-6-2-3-9(8-16)13(17)20-12-5-4-10(15)7-11(12)14/h4-5,7,9H,2-3,6,8H2,1H3 |
| InChIKey | SEZVAZSWJUUXBL-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.69 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|