C20H19BrClNO4S — CID 26212982
(2-bromo-4-chlorophenyl) 1-[(E)-2-phenylethenyl]sulfonylpiperidine-4-carboxylate (PubChem CID 26212982) has the molecular formula C20H19BrClNO4S and a molecular weight of 484.80 g/mol. Its IUPAC name is (2-bromo-4-chlorophenyl) 1-[(E)-2-phenylethenyl]sulfonylpiperidine-4-carboxylate.
| Compound Name | (2-bromo-4-chlorophenyl) 1-[(E)-2-phenylethenyl]sulfonylpiperidine-4-carboxylate |
|---|---|
| PubChem CID | 26212982 |
| Molecular Formula | C20H19BrClNO4S |
| Molecular Weight | 484.80 g/mol |
| Exact Mass | 482.99 |
| IUPAC Name | (2-bromo-4-chlorophenyl) 1-[(E)-2-phenylethenyl]sulfonylpiperidine-4-carboxylate |
| SMILES | O=C(Oc1ccc(Cl)cc1Br)C1CCN(S(=O)(=O)/C=C/c2ccccc2)CC1 |
| InChI | InChI=1S/C20H19BrClNO4S/c21-18-14-17(22)6-7-19(18)27-20(24)16-8-11-23(12-9-16)28(25,26)13-10-15-4-2-1-3-5-15/h1-7,10,13-14,16H,8-9,11-12H2/b13-10+ |
| InChIKey | ICQBNFBEZJLYDB-JLHYYAGUSA-N |
| XLogP | 4.72 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.80 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|