C21H25N3O3S — CID 9480115
N'-methyl-N'-phenyl-1-[(E)-2-phenylethenyl]sulfonylpiperidine-4-carbohydrazide (PubChem CID 9480115) has the molecular formula C21H25N3O3S and a molecular weight of 399.52 g/mol. Its IUPAC name is N'-methyl-N'-phenyl-1-[(E)-2-phenylethenyl]sulfonylpiperidine-4-carbohydrazide.
| Compound Name | N'-methyl-N'-phenyl-1-[(E)-2-phenylethenyl]sulfonylpiperidine-4-carbohydrazide |
|---|---|
| PubChem CID | 9480115 |
| Molecular Formula | C21H25N3O3S |
| Molecular Weight | 399.52 g/mol |
| Exact Mass | 399.16 |
| IUPAC Name | N'-methyl-N'-phenyl-1-[(E)-2-phenylethenyl]sulfonylpiperidine-4-carbohydrazide |
| SMILES | CN(NC(=O)C1CCN(S(=O)(=O)/C=C/c2ccccc2)CC1)c1ccccc1 |
| InChI | InChI=1S/C21H25N3O3S/c1-23(20-10-6-3-7-11-20)22-21(25)19-12-15-24(16-13-19)28(26,27)17-14-18-8-4-2-5-9-18/h2-11,14,17,19H,12-13,15-16H2,1H3,(H,22,25)/b17-14+ |
| InChIKey | QATOAPFAUWBLSA-SAPNQHFASA-N |
| XLogP | 2.87 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.52 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|