C23H26N2O3S — CID 55551266
N-phenyl-1-[(E)-2-phenylethenyl]sulfonyl-N-prop-2-enylpiperidine-4-carboxamide (PubChem CID 55551266) has the molecular formula C23H26N2O3S and a molecular weight of 410.54 g/mol. Its IUPAC name is N-phenyl-1-[(E)-2-phenylethenyl]sulfonyl-N-prop-2-enylpiperidine-4-carboxamide.
| Compound Name | N-phenyl-1-[(E)-2-phenylethenyl]sulfonyl-N-prop-2-enylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 55551266 |
| Molecular Formula | C23H26N2O3S |
| Molecular Weight | 410.54 g/mol |
| Exact Mass | 410.17 |
| IUPAC Name | N-phenyl-1-[(E)-2-phenylethenyl]sulfonyl-N-prop-2-enylpiperidine-4-carboxamide |
| SMILES | C=CCN(C(=O)C1CCN(S(=O)(=O)/C=C/c2ccccc2)CC1)c1ccccc1 |
| InChI | InChI=1S/C23H26N2O3S/c1-2-16-25(22-11-7-4-8-12-22)23(26)21-13-17-24(18-14-21)29(27,28)19-15-20-9-5-3-6-10-20/h2-12,15,19,21H,1,13-14,16-18H2/b19-15+ |
| InChIKey | YNVBWHBYSKBPKO-XDJHFCHBSA-N |
| XLogP | 3.92 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.54 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|