C20H22N2O3S — CID 91409956
4-[1-(2-phenylethenylsulfonyl)piperidin-4-yl]benzamide (PubChem CID 91409956) has the molecular formula C20H22N2O3S and a molecular weight of 370.47 g/mol. Its IUPAC name is 4-[1-(2-phenylethenylsulfonyl)piperidin-4-yl]benzamide.
| Compound Name | 4-[1-(2-phenylethenylsulfonyl)piperidin-4-yl]benzamide |
|---|---|
| PubChem CID | 91409956 |
| Molecular Formula | C20H22N2O3S |
| Molecular Weight | 370.47 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | 4-[1-(2-phenylethenylsulfonyl)piperidin-4-yl]benzamide |
| SMILES | NC(=O)c1ccc(C2CCN(S(=O)(=O)C=Cc3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C20H22N2O3S/c21-20(23)19-8-6-17(7-9-19)18-10-13-22(14-11-18)26(24,25)15-12-16-4-2-1-3-5-16/h1-9,12,15,18H,10-11,13-14H2,(H2,21,23) |
| InChIKey | FTGVKNDOFIPBSM-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.47 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |