C19H26N2O4S — CID 51291409
(2-methylmorpholin-4-yl)-[1-[(E)-2-phenylethenyl]sulfonylpiperidin-4-yl]methanone (PubChem CID 51291409) has the molecular formula C19H26N2O4S and a molecular weight of 378.49 g/mol. Its IUPAC name is (2-methylmorpholin-4-yl)-[1-[(E)-2-phenylethenyl]sulfonylpiperidin-4-yl]methanone.
| Compound Name | (2-methylmorpholin-4-yl)-[1-[(E)-2-phenylethenyl]sulfonylpiperidin-4-yl]methanone |
|---|---|
| PubChem CID | 51291409 |
| Molecular Formula | C19H26N2O4S |
| Molecular Weight | 378.49 g/mol |
| Exact Mass | 378.16 |
| IUPAC Name | (2-methylmorpholin-4-yl)-[1-[(E)-2-phenylethenyl]sulfonylpiperidin-4-yl]methanone |
| SMILES | CC1CN(C(=O)C2CCN(S(=O)(=O)/C=C/c3ccccc3)CC2)CCO1 |
| InChI | InChI=1S/C19H26N2O4S/c1-16-15-20(12-13-25-16)19(22)18-7-10-21(11-8-18)26(23,24)14-9-17-5-3-2-4-6-17/h2-6,9,14,16,18H,7-8,10-13,15H2,1H3/b14-9+ |
| InChIKey | YFYBZTDYLXWIQI-NTEUORMPSA-N |
| XLogP | 1.95 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.49 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |