C22H25ClN2O3S2 — CID 43025033
N-[(5-chlorothiophen-2-yl)methyl]-1-[(E)-2-phenylethenyl]sulfonyl-N-prop-2-enylpiperidine-4-carboxamide (PubChem CID 43025033) has the molecular formula C22H25ClN2O3S2 and a molecular weight of 465.04 g/mol. Its IUPAC name is N-[(5-chlorothiophen-2-yl)methyl]-1-[(E)-2-phenylethenyl]sulfonyl-N-prop-2-enylpiperidine-4-carboxamide.
| Compound Name | N-[(5-chlorothiophen-2-yl)methyl]-1-[(E)-2-phenylethenyl]sulfonyl-N-prop-2-enylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 43025033 |
| Molecular Formula | C22H25ClN2O3S2 |
| Molecular Weight | 465.04 g/mol |
| Exact Mass | 464.10 |
| IUPAC Name | N-[(5-chlorothiophen-2-yl)methyl]-1-[(E)-2-phenylethenyl]sulfonyl-N-prop-2-enylpiperidine-4-carboxamide |
| SMILES | C=CCN(Cc1ccc(Cl)s1)C(=O)C1CCN(S(=O)(=O)/C=C/c2ccccc2)CC1 |
| InChI | InChI=1S/C22H25ClN2O3S2/c1-2-13-24(17-20-8-9-21(23)29-20)22(26)19-10-14-25(15-11-19)30(27,28)16-12-18-6-4-3-5-7-18/h2-9,12,16,19H,1,10-11,13-15,17H2/b16-12+ |
| InChIKey | IBDPSMVYUDNJSE-FOWTUZBSSA-N |
| XLogP | 4.63 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.04 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|