C20H21ClN2O3S2 — CID 38966225
(E)-N-[(5-chlorothiophen-2-yl)methyl]-3-[4-(cyclopropylsulfamoyl)phenyl]-N-prop-2-enylprop-2-enamide (PubChem CID 38966225) has the molecular formula C20H21ClN2O3S2 and a molecular weight of 436.99 g/mol. Its IUPAC name is (E)-N-[(5-chlorothiophen-2-yl)methyl]-3-[4-(cyclopropylsulfamoyl)phenyl]-N-prop-2-enylprop-2-enamide.
| Compound Name | (E)-N-[(5-chlorothiophen-2-yl)methyl]-3-[4-(cyclopropylsulfamoyl)phenyl]-N-prop-2-enylprop-2-enamide |
|---|---|
| PubChem CID | 38966225 |
| Molecular Formula | C20H21ClN2O3S2 |
| Molecular Weight | 436.99 g/mol |
| Exact Mass | 436.07 |
| IUPAC Name | (E)-N-[(5-chlorothiophen-2-yl)methyl]-3-[4-(cyclopropylsulfamoyl)phenyl]-N-prop-2-enylprop-2-enamide |
| SMILES | C=CCN(Cc1ccc(Cl)s1)C(=O)/C=C/c1ccc(S(=O)(=O)NC2CC2)cc1 |
| InChI | InChI=1S/C20H21ClN2O3S2/c1-2-13-23(14-17-8-11-19(21)27-17)20(24)12-5-15-3-9-18(10-4-15)28(25,26)22-16-6-7-16/h2-5,8-12,16,22H,1,6-7,13-14H2/b12-5+ |
| InChIKey | PRXVIHWZNKGIHP-LFYBBSHMSA-N |
| XLogP | 4.07 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.99 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|