C23H28N2O3S — CID 55687745
(E)-N-benzyl-N-butan-2-yl-3-[4-(cyclopropylsulfamoyl)phenyl]prop-2-enamide (PubChem CID 55687745) has the molecular formula C23H28N2O3S and a molecular weight of 412.56 g/mol. Its IUPAC name is (E)-N-benzyl-N-butan-2-yl-3-[4-(cyclopropylsulfamoyl)phenyl]prop-2-enamide.
| Compound Name | (E)-N-benzyl-N-butan-2-yl-3-[4-(cyclopropylsulfamoyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 55687745 |
| Molecular Formula | C23H28N2O3S |
| Molecular Weight | 412.56 g/mol |
| Exact Mass | 412.18 |
| IUPAC Name | (E)-N-benzyl-N-butan-2-yl-3-[4-(cyclopropylsulfamoyl)phenyl]prop-2-enamide |
| SMILES | CCC(C)N(Cc1ccccc1)C(=O)/C=C/c1ccc(S(=O)(=O)NC2CC2)cc1 |
| InChI | InChI=1S/C23H28N2O3S/c1-3-18(2)25(17-20-7-5-4-6-8-20)23(26)16-11-19-9-14-22(15-10-19)29(27,28)24-21-12-13-21/h4-11,14-16,18,21,24H,3,12-13,17H2,1-2H3/b16-11+ |
| InChIKey | DSTZXHRLSOHJAV-LFIBNONCSA-N |
| XLogP | 3.97 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.56 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|