C20H24N2O4S — CID 55687353
(E)-3-[4-(cyclopropylsulfamoyl)phenyl]-N-[4-(furan-2-yl)butan-2-yl]prop-2-enamide (PubChem CID 55687353) has the molecular formula C20H24N2O4S and a molecular weight of 388.49 g/mol. Its IUPAC name is (E)-3-[4-(cyclopropylsulfamoyl)phenyl]-N-[4-(furan-2-yl)butan-2-yl]prop-2-enamide.
| Compound Name | (E)-3-[4-(cyclopropylsulfamoyl)phenyl]-N-[4-(furan-2-yl)butan-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 55687353 |
| Molecular Formula | C20H24N2O4S |
| Molecular Weight | 388.49 g/mol |
| Exact Mass | 388.15 |
| IUPAC Name | (E)-3-[4-(cyclopropylsulfamoyl)phenyl]-N-[4-(furan-2-yl)butan-2-yl]prop-2-enamide |
| SMILES | CC(CCc1ccco1)NC(=O)/C=C/c1ccc(S(=O)(=O)NC2CC2)cc1 |
| InChI | InChI=1S/C20H24N2O4S/c1-15(4-10-18-3-2-14-26-18)21-20(23)13-7-16-5-11-19(12-6-16)27(24,25)22-17-8-9-17/h2-3,5-7,11-15,17,22H,4,8-10H2,1H3,(H,21,23)/b13-7+ |
| InChIKey | SWYVDCZSIUPTKS-NTUHNPAUSA-N |
| XLogP | 2.87 |
| TPSA | 88.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.49 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|