C14H22N2O2 — CID 114084833
(3S,4S)-N-[4-(furan-2-yl)butan-2-yl]-4-methylpyrrolidine-3-carboxamide (PubChem CID 114084833) has the molecular formula C14H22N2O2 and a molecular weight of 250.34 g/mol. Its IUPAC name is (3S,4S)-N-[4-(furan-2-yl)butan-2-yl]-4-methylpyrrolidine-3-carboxamide.
| Compound Name | (3S,4S)-N-[4-(furan-2-yl)butan-2-yl]-4-methylpyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 114084833 |
| Molecular Formula | C14H22N2O2 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.17 |
| IUPAC Name | (3S,4S)-N-[4-(furan-2-yl)butan-2-yl]-4-methylpyrrolidine-3-carboxamide |
| SMILES | CC(CCc1ccco1)NC(=O)[C@@H]1CNC[C@H]1C |
| InChI | InChI=1S/C14H22N2O2/c1-10-8-15-9-13(10)14(17)16-11(2)5-6-12-4-3-7-18-12/h3-4,7,10-11,13,15H,5-6,8-9H2,1-2H3,(H,16,17)/t10-,11?,13-/m1/s1 |
| InChIKey | DZOYBYHHWTZDRR-IAUSTGCCSA-N |
| XLogP | 1.57 |
| TPSA | 54.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |