C11H18N2O2 — CID 115571916
1-ethyl-3-[4-(furan-2-yl)butan-2-yl]urea (PubChem CID 115571916) has the molecular formula C11H18N2O2 and a molecular weight of 210.28 g/mol. Its IUPAC name is 1-ethyl-3-[4-(furan-2-yl)butan-2-yl]urea.
| Compound Name | 1-ethyl-3-[4-(furan-2-yl)butan-2-yl]urea |
|---|---|
| PubChem CID | 115571916 |
| Molecular Formula | C11H18N2O2 |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.14 |
| IUPAC Name | 1-ethyl-3-[4-(furan-2-yl)butan-2-yl]urea |
| SMILES | CCNC(=O)NC(C)CCc1ccco1 |
| InChI | InChI=1S/C11H18N2O2/c1-3-12-11(14)13-9(2)6-7-10-5-4-8-15-10/h4-5,8-9H,3,6-7H2,1-2H3,(H2,12,13,14) |
| InChIKey | BXXNOGBCPZIXGN-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 54.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |