C11H17NO3 — CID 60651451
ethyl N-[4-(furan-2-yl)butan-2-yl]carbamate (PubChem CID 60651451) has the molecular formula C11H17NO3 and a molecular weight of 211.26 g/mol. Its IUPAC name is ethyl N-[4-(furan-2-yl)butan-2-yl]carbamate.
| Compound Name | ethyl N-[4-(furan-2-yl)butan-2-yl]carbamate |
|---|---|
| PubChem CID | 60651451 |
| Molecular Formula | C11H17NO3 |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.12 |
| IUPAC Name | ethyl N-[4-(furan-2-yl)butan-2-yl]carbamate |
| SMILES | CCOC(=O)NC(C)CCc1ccco1 |
| InChI | InChI=1S/C11H17NO3/c1-3-14-11(13)12-9(2)6-7-10-5-4-8-15-10/h4-5,8-9H,3,6-7H2,1-2H3,(H,12,13) |
| InChIKey | QEUUDGVNMIJZJE-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |