C10H13NO5 — CID 68697822
2-(ethoxycarbonylamino)-3-(furan-2-yl)propanoic acid (PubChem CID 68697822) has the molecular formula C10H13NO5 and a molecular weight of 227.22 g/mol. Its IUPAC name is 2-(ethoxycarbonylamino)-3-(furan-2-yl)propanoic acid.
| Compound Name | 2-(ethoxycarbonylamino)-3-(furan-2-yl)propanoic acid |
|---|---|
| PubChem CID | 68697822 |
| Molecular Formula | C10H13NO5 |
| Molecular Weight | 227.22 g/mol |
| Exact Mass | 227.08 |
| IUPAC Name | 2-(ethoxycarbonylamino)-3-(furan-2-yl)propanoic acid |
| SMILES | CCOC(=O)NC(Cc1ccco1)C(=O)O |
| InChI | InChI=1S/C10H13NO5/c1-2-15-10(14)11-8(9(12)13)6-7-4-3-5-16-7/h3-5,8H,2,6H2,1H3,(H,11,14)(H,12,13) |
| InChIKey | NXCMKHXJXLCLKK-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 88.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.22 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |