C16H26N2O4 — CID 38924524
ethyl N-[(2S)-1-[3-(furan-2-yl)propanoylamino]-4-methylpentan-2-yl]carbamate (PubChem CID 38924524) has the molecular formula C16H26N2O4 and a molecular weight of 310.39 g/mol. Its IUPAC name is ethyl N-[(2S)-1-[3-(furan-2-yl)propanoylamino]-4-methylpentan-2-yl]carbamate.
| Compound Name | ethyl N-[(2S)-1-[3-(furan-2-yl)propanoylamino]-4-methylpentan-2-yl]carbamate |
|---|---|
| PubChem CID | 38924524 |
| Molecular Formula | C16H26N2O4 |
| Molecular Weight | 310.39 g/mol |
| Exact Mass | 310.19 |
| IUPAC Name | ethyl N-[(2S)-1-[3-(furan-2-yl)propanoylamino]-4-methylpentan-2-yl]carbamate |
| SMILES | CCOC(=O)N[C@H](CNC(=O)CCc1ccco1)CC(C)C |
| InChI | InChI=1S/C16H26N2O4/c1-4-21-16(20)18-13(10-12(2)3)11-17-15(19)8-7-14-6-5-9-22-14/h5-6,9,12-13H,4,7-8,10-11H2,1-3H3,(H,17,19)(H,18,20)/t13-/m0/s1 |
| InChIKey | YPVKMANUHOHDFN-ZDUSSCGKSA-N |
| XLogP | 2.49 |
| TPSA | 80.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.39 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |