C9H13NO2 — CID 60690706
N-ethyl-3-(furan-2-yl)propanamide (PubChem CID 60690706) has the molecular formula C9H13NO2 and a molecular weight of 167.21 g/mol. Its IUPAC name is N-ethyl-3-(furan-2-yl)propanamide.
| Compound Name | N-ethyl-3-(furan-2-yl)propanamide |
|---|---|
| PubChem CID | 60690706 |
| Molecular Formula | C9H13NO2 |
| Molecular Weight | 167.21 g/mol |
| Exact Mass | 167.09 |
| IUPAC Name | N-ethyl-3-(furan-2-yl)propanamide |
| SMILES | CCNC(=O)CCc1ccco1 |
| InChI | InChI=1S/C9H13NO2/c1-2-10-9(11)6-5-8-4-3-7-12-8/h3-4,7H,2,5-6H2,1H3,(H,10,11) |
| InChIKey | QJWWPNPGICWHDD-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.21 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |