C10H15NO3 — CID 83032070
3-(furan-2-yl)-N-[(2R)-2-hydroxypropyl]propanamide (PubChem CID 83032070) has the molecular formula C10H15NO3 and a molecular weight of 197.23 g/mol. Its IUPAC name is 3-(furan-2-yl)-N-[(2R)-2-hydroxypropyl]propanamide.
| Compound Name | 3-(furan-2-yl)-N-[(2R)-2-hydroxypropyl]propanamide |
|---|---|
| PubChem CID | 83032070 |
| Molecular Formula | C10H15NO3 |
| Molecular Weight | 197.23 g/mol |
| Exact Mass | 197.11 |
| IUPAC Name | 3-(furan-2-yl)-N-[(2R)-2-hydroxypropyl]propanamide |
| SMILES | C[C@@H](O)CNC(=O)CCc1ccco1 |
| InChI | InChI=1S/C10H15NO3/c1-8(12)7-11-10(13)5-4-9-3-2-6-14-9/h2-3,6,8,12H,4-5,7H2,1H3,(H,11,13)/t8-/m1/s1 |
| InChIKey | XZPHABYCEATGCS-MRVPVSSYSA-N |
| XLogP | 0.71 |
| TPSA | 62.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.23 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |