C20H27NO4 — CID 110312529
N-[2-(3,4-dimethoxyphenyl)-3-methylbutyl]-3-(furan-2-yl)propanamide (PubChem CID 110312529) has the molecular formula C20H27NO4 and a molecular weight of 345.44 g/mol. Its IUPAC name is N-[2-(3,4-dimethoxyphenyl)-3-methylbutyl]-3-(furan-2-yl)propanamide.
| Compound Name | N-[2-(3,4-dimethoxyphenyl)-3-methylbutyl]-3-(furan-2-yl)propanamide |
|---|---|
| PubChem CID | 110312529 |
| Molecular Formula | C20H27NO4 |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.19 |
| IUPAC Name | N-[2-(3,4-dimethoxyphenyl)-3-methylbutyl]-3-(furan-2-yl)propanamide |
| SMILES | COc1ccc(C(CNC(=O)CCc2ccco2)C(C)C)cc1OC |
| InChI | InChI=1S/C20H27NO4/c1-14(2)17(15-7-9-18(23-3)19(12-15)24-4)13-21-20(22)10-8-16-6-5-11-25-16/h5-7,9,11-12,14,17H,8,10,13H2,1-4H3,(H,21,22) |
| InChIKey | QGRJOGJQISNDER-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 60.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |