C18H23NO4 — CID 110314871
N-[2-(3,4-dimethoxyphenyl)-3-methylbutyl]furan-2-carboxamide (PubChem CID 110314871) has the molecular formula C18H23NO4 and a molecular weight of 317.39 g/mol. Its IUPAC name is N-[2-(3,4-dimethoxyphenyl)-3-methylbutyl]furan-2-carboxamide.
| Compound Name | N-[2-(3,4-dimethoxyphenyl)-3-methylbutyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 110314871 |
| Molecular Formula | C18H23NO4 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.16 |
| IUPAC Name | N-[2-(3,4-dimethoxyphenyl)-3-methylbutyl]furan-2-carboxamide |
| SMILES | COc1ccc(C(CNC(=O)c2ccco2)C(C)C)cc1OC |
| InChI | InChI=1S/C18H23NO4/c1-12(2)14(11-19-18(20)16-6-5-9-23-16)13-7-8-15(21-3)17(10-13)22-4/h5-10,12,14H,11H2,1-4H3,(H,19,20) |
| InChIKey | YTSCFSIUYAYEMR-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 60.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |