C15H17NO5 — CID 78867802
N-[2-(furan-2-yl)-2-hydroxyethyl]-3,4-dimethoxybenzamide (PubChem CID 78867802) has the molecular formula C15H17NO5 and a molecular weight of 291.30 g/mol. Its IUPAC name is N-[2-(furan-2-yl)-2-hydroxyethyl]-3,4-dimethoxybenzamide.
| Compound Name | N-[2-(furan-2-yl)-2-hydroxyethyl]-3,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 78867802 |
| Molecular Formula | C15H17NO5 |
| Molecular Weight | 291.30 g/mol |
| Exact Mass | 291.11 |
| IUPAC Name | N-[2-(furan-2-yl)-2-hydroxyethyl]-3,4-dimethoxybenzamide |
| SMILES | COc1ccc(C(=O)NCC(O)c2ccco2)cc1OC |
| InChI | InChI=1S/C15H17NO5/c1-19-13-6-5-10(8-14(13)20-2)15(18)16-9-11(17)12-4-3-7-21-12/h3-8,11,17H,9H2,1-2H3,(H,16,18) |
| InChIKey | CSMDFEUBRQNWPJ-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 80.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.30 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |