C13H11Cl2NO3 — CID 110889301
3,4-dichloro-N-[2-(furan-2-yl)-2-hydroxyethyl]benzamide (PubChem CID 110889301) has the molecular formula C13H11Cl2NO3 and a molecular weight of 300.14 g/mol. Its IUPAC name is 3,4-dichloro-N-[2-(furan-2-yl)-2-hydroxyethyl]benzamide.
| Compound Name | 3,4-dichloro-N-[2-(furan-2-yl)-2-hydroxyethyl]benzamide |
|---|---|
| PubChem CID | 110889301 |
| Molecular Formula | C13H11Cl2NO3 |
| Molecular Weight | 300.14 g/mol |
| Exact Mass | 299.01 |
| IUPAC Name | 3,4-dichloro-N-[2-(furan-2-yl)-2-hydroxyethyl]benzamide |
| SMILES | O=C(NCC(O)c1ccco1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C13H11Cl2NO3/c14-9-4-3-8(6-10(9)15)13(18)16-7-11(17)12-2-1-5-19-12/h1-6,11,17H,7H2,(H,16,18) |
| InChIKey | HUFJVDSIZBUTJL-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 62.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.14 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |