C11H10BrNO3S — CID 110889015
5-bromo-N-[2-(furan-2-yl)-2-hydroxyethyl]thiophene-3-carboxamide (PubChem CID 110889015) has the molecular formula C11H10BrNO3S and a molecular weight of 316.18 g/mol. Its IUPAC name is 5-bromo-N-[2-(furan-2-yl)-2-hydroxyethyl]thiophene-3-carboxamide.
| Compound Name | 5-bromo-N-[2-(furan-2-yl)-2-hydroxyethyl]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 110889015 |
| Molecular Formula | C11H10BrNO3S |
| Molecular Weight | 316.18 g/mol |
| Exact Mass | 314.96 |
| IUPAC Name | 5-bromo-N-[2-(furan-2-yl)-2-hydroxyethyl]thiophene-3-carboxamide |
| SMILES | O=C(NCC(O)c1ccco1)c1csc(Br)c1 |
| InChI | InChI=1S/C11H10BrNO3S/c12-10-4-7(6-17-10)11(15)13-5-8(14)9-2-1-3-16-9/h1-4,6,8,14H,5H2,(H,13,15) |
| InChIKey | RTLXYGLOCCZKRB-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 62.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.18 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |