C18H24N2O4 — CID 51162709
N-[2-(dimethylamino)-2-(furan-2-yl)ethyl]-4-ethoxy-3-methoxybenzamide (PubChem CID 51162709) has the molecular formula C18H24N2O4 and a molecular weight of 332.40 g/mol. Its IUPAC name is N-[2-(dimethylamino)-2-(furan-2-yl)ethyl]-4-ethoxy-3-methoxybenzamide.
| Compound Name | N-[2-(dimethylamino)-2-(furan-2-yl)ethyl]-4-ethoxy-3-methoxybenzamide |
|---|---|
| PubChem CID | 51162709 |
| Molecular Formula | C18H24N2O4 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.17 |
| IUPAC Name | N-[2-(dimethylamino)-2-(furan-2-yl)ethyl]-4-ethoxy-3-methoxybenzamide |
| SMILES | CCOc1ccc(C(=O)NCC(c2ccco2)N(C)C)cc1OC |
| InChI | InChI=1S/C18H24N2O4/c1-5-23-16-9-8-13(11-17(16)22-4)18(21)19-12-14(20(2)3)15-7-6-10-24-15/h6-11,14H,5,12H2,1-4H3,(H,19,21) |
| InChIKey | DEFQVWCLLMKNNR-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 63.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |