C16H16NO6- — CID 6943067
(3S)-3-(3,4-dimethoxyphenyl)-3-(furan-2-carbonylamino)propanoate (PubChem CID 6943067) has the molecular formula C16H16NO6- and a molecular weight of 318.31 g/mol. Its IUPAC name is (3S)-3-(3,4-dimethoxyphenyl)-3-(furan-2-carbonylamino)propanoate.
| Compound Name | (3S)-3-(3,4-dimethoxyphenyl)-3-(furan-2-carbonylamino)propanoate |
|---|---|
| PubChem CID | 6943067 |
| Molecular Formula | C16H16NO6- |
| Molecular Weight | 318.31 g/mol |
| Exact Mass | 318.10 |
| IUPAC Name | (3S)-3-(3,4-dimethoxyphenyl)-3-(furan-2-carbonylamino)propanoate |
| SMILES | COc1ccc([C@H](CC(=O)[O-])NC(=O)c2ccco2)cc1OC |
| InChI | InChI=1S/C16H17NO6/c1-21-12-6-5-10(8-14(12)22-2)11(9-15(18)19)17-16(20)13-4-3-7-23-13/h3-8,11H,9H2,1-2H3,(H,17,20)(H,18,19)/p-1/t11-/m0/s1 |
| InChIKey | ITCRVQYXNASVEK-NSHDSACASA-M |
| XLogP | 0.91 |
| TPSA | 100.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.31 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |