C14H12NO4- — CID 6942649
(3S)-3-(furan-2-carbonylamino)-3-phenylpropanoate (PubChem CID 6942649) has the molecular formula C14H12NO4- and a molecular weight of 258.25 g/mol. Its IUPAC name is (3S)-3-(furan-2-carbonylamino)-3-phenylpropanoate.
| Compound Name | (3S)-3-(furan-2-carbonylamino)-3-phenylpropanoate |
|---|---|
| PubChem CID | 6942649 |
| Molecular Formula | C14H12NO4- |
| Molecular Weight | 258.25 g/mol |
| Exact Mass | 258.08 |
| IUPAC Name | (3S)-3-(furan-2-carbonylamino)-3-phenylpropanoate |
| SMILES | O=C([O-])C[C@H](NC(=O)c1ccco1)c1ccccc1 |
| InChI | InChI=1S/C14H13NO4/c16-13(17)9-11(10-5-2-1-3-6-10)15-14(18)12-7-4-8-19-12/h1-8,11H,9H2,(H,15,18)(H,16,17)/p-1/t11-/m0/s1 |
| InChIKey | MMPXOXNLAORIRR-NSHDSACASA-M |
| XLogP | 0.89 |
| TPSA | 82.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.25 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |