C9H7NO6-2 — CID 6923142
(2S)-2-(furan-2-carbonylamino)butanedioate (PubChem CID 6923142) has the molecular formula C9H7NO6-2 and a molecular weight of 225.16 g/mol. Its IUPAC name is (2S)-2-(furan-2-carbonylamino)butanedioate.
| Compound Name | (2S)-2-(furan-2-carbonylamino)butanedioate |
|---|---|
| PubChem CID | 6923142 |
| Molecular Formula | C9H7NO6-2 |
| Molecular Weight | 225.16 g/mol |
| Exact Mass | 225.03 |
| IUPAC Name | (2S)-2-(furan-2-carbonylamino)butanedioate |
| SMILES | O=C([O-])C[C@H](NC(=O)c1ccco1)C(=O)[O-] |
| InChI | InChI=1S/C9H9NO6/c11-7(12)4-5(9(14)15)10-8(13)6-2-1-3-16-6/h1-3,5H,4H2,(H,10,13)(H,11,12)(H,14,15)/p-2/t5-/m0/s1 |
| InChIKey | YQTLEIHRDNVLQE-YFKPBYRVSA-L |
| XLogP | -2.73 |
| TPSA | 122.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.16 |
| LogP ≤ 5 | -2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |