C16H15N2O5- — CID 7430265
(2R)-2-[[2-(furan-2-carbonylamino)benzoyl]amino]butanoate (PubChem CID 7430265) has the molecular formula C16H15N2O5- and a molecular weight of 315.31 g/mol. Its IUPAC name is (2R)-2-[[2-(furan-2-carbonylamino)benzoyl]amino]butanoate.
| Compound Name | (2R)-2-[[2-(furan-2-carbonylamino)benzoyl]amino]butanoate |
|---|---|
| PubChem CID | 7430265 |
| Molecular Formula | C16H15N2O5- |
| Molecular Weight | 315.31 g/mol |
| Exact Mass | 315.10 |
| IUPAC Name | (2R)-2-[[2-(furan-2-carbonylamino)benzoyl]amino]butanoate |
| SMILES | CC[C@@H](NC(=O)c1ccccc1NC(=O)c1ccco1)C(=O)[O-] |
| InChI | InChI=1S/C16H16N2O5/c1-2-11(16(21)22)17-14(19)10-6-3-4-7-12(10)18-15(20)13-8-5-9-23-13/h3-9,11H,2H2,1H3,(H,17,19)(H,18,20)(H,21,22)/p-1/t11-/m1/s1 |
| InChIKey | NCZOQPHQZJOIEL-LLVKDONJSA-M |
| XLogP | 0.79 |
| TPSA | 111.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.31 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |