C22H27N3O4 — CID 2930202
N-[2-[[1-(cyclohexylamino)-1-oxobutan-2-yl]carbamoyl]phenyl]furan-2-carboxamide (PubChem CID 2930202) has the molecular formula C22H27N3O4 and a molecular weight of 397.48 g/mol. Its IUPAC name is N-[2-[[1-(cyclohexylamino)-1-oxobutan-2-yl]carbamoyl]phenyl]furan-2-carboxamide.
| Compound Name | N-[2-[[1-(cyclohexylamino)-1-oxobutan-2-yl]carbamoyl]phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 2930202 |
| Molecular Formula | C22H27N3O4 |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.20 |
| IUPAC Name | N-[2-[[1-(cyclohexylamino)-1-oxobutan-2-yl]carbamoyl]phenyl]furan-2-carboxamide |
| SMILES | CCC(NC(=O)c1ccccc1NC(=O)c1ccco1)C(=O)NC1CCCCC1 |
| InChI | InChI=1S/C22H27N3O4/c1-2-17(21(27)23-15-9-4-3-5-10-15)24-20(26)16-11-6-7-12-18(16)25-22(28)19-13-8-14-29-19/h6-8,11-15,17H,2-5,9-10H2,1H3,(H,23,27)(H,24,26)(H,25,28) |
| InChIKey | ONDDXHVCGRDWEB-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 100.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |