C16H12N2O7-2 — CID 7760340
(2S)-2-[[2-(furan-2-carbonylamino)benzoyl]amino]butanedioate (PubChem CID 7760340) has the molecular formula C16H12N2O7-2 and a molecular weight of 344.28 g/mol. Its IUPAC name is (2S)-2-[[2-(furan-2-carbonylamino)benzoyl]amino]butanedioate.
| Compound Name | (2S)-2-[[2-(furan-2-carbonylamino)benzoyl]amino]butanedioate |
|---|---|
| PubChem CID | 7760340 |
| Molecular Formula | C16H12N2O7-2 |
| Molecular Weight | 344.28 g/mol |
| Exact Mass | 344.07 |
| IUPAC Name | (2S)-2-[[2-(furan-2-carbonylamino)benzoyl]amino]butanedioate |
| SMILES | O=C([O-])C[C@H](NC(=O)c1ccccc1NC(=O)c1ccco1)C(=O)[O-] |
| InChI | InChI=1S/C16H14N2O7/c19-13(20)8-11(16(23)24)18-14(21)9-4-1-2-5-10(9)17-15(22)12-6-3-7-25-12/h1-7,11H,8H2,(H,17,22)(H,18,21)(H,19,20)(H,23,24)/p-2/t11-/m0/s1 |
| InChIKey | UTIOSSOVVQHGNA-NSHDSACASA-L |
| XLogP | -1.48 |
| TPSA | 151.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.28 |
| LogP ≤ 5 | -1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |