C17H17N2O5- — CID 4158153
2-[[2-(furan-2-carbonylamino)benzoyl]amino]-3-methylbutanoate (PubChem CID 4158153) has the molecular formula C17H17N2O5- and a molecular weight of 329.33 g/mol. Its IUPAC name is 2-[[2-(furan-2-carbonylamino)benzoyl]amino]-3-methylbutanoate.
| Compound Name | 2-[[2-(furan-2-carbonylamino)benzoyl]amino]-3-methylbutanoate |
|---|---|
| PubChem CID | 4158153 |
| Molecular Formula | C17H17N2O5- |
| Molecular Weight | 329.33 g/mol |
| Exact Mass | 329.11 |
| IUPAC Name | 2-[[2-(furan-2-carbonylamino)benzoyl]amino]-3-methylbutanoate |
| SMILES | CC(C)C(NC(=O)c1ccccc1NC(=O)c1ccco1)C(=O)[O-] |
| InChI | InChI=1S/C17H18N2O5/c1-10(2)14(17(22)23)19-15(20)11-6-3-4-7-12(11)18-16(21)13-8-5-9-24-13/h3-10,14H,1-2H3,(H,18,21)(H,19,20)(H,22,23)/p-1 |
| InChIKey | OZWZHLMZGHMSJE-UHFFFAOYSA-M |
| XLogP | 1.04 |
| TPSA | 111.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.33 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |