C15H15N3O4 — CID 126003002
N-[2-[(propanoylamino)carbamoyl]phenyl]furan-2-carboxamide (PubChem CID 126003002) has the molecular formula C15H15N3O4 and a molecular weight of 301.30 g/mol. Its IUPAC name is N-[2-[(propanoylamino)carbamoyl]phenyl]furan-2-carboxamide.
| Compound Name | N-[2-[(propanoylamino)carbamoyl]phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 126003002 |
| Molecular Formula | C15H15N3O4 |
| Molecular Weight | 301.30 g/mol |
| Exact Mass | 301.11 |
| IUPAC Name | N-[2-[(propanoylamino)carbamoyl]phenyl]furan-2-carboxamide |
| SMILES | CCC(=O)NNC(=O)c1ccccc1NC(=O)c1ccco1 |
| InChI | InChI=1S/C15H15N3O4/c1-2-13(19)17-18-14(20)10-6-3-4-7-11(10)16-15(21)12-8-5-9-22-12/h3-9H,2H2,1H3,(H,16,21)(H,17,19)(H,18,20) |
| InChIKey | HZIHPPKARPZYIV-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 100.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.30 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|