C21H17N2O5- — CID 7482305
(2S)-2-[[2-(furan-2-carbonylamino)benzoyl]amino]-3-phenylpropanoate (PubChem CID 7482305) has the molecular formula C21H17N2O5- and a molecular weight of 377.38 g/mol. Its IUPAC name is (2S)-2-[[2-(furan-2-carbonylamino)benzoyl]amino]-3-phenylpropanoate.
| Compound Name | (2S)-2-[[2-(furan-2-carbonylamino)benzoyl]amino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 7482305 |
| Molecular Formula | C21H17N2O5- |
| Molecular Weight | 377.38 g/mol |
| Exact Mass | 377.11 |
| IUPAC Name | (2S)-2-[[2-(furan-2-carbonylamino)benzoyl]amino]-3-phenylpropanoate |
| SMILES | O=C(Nc1ccccc1C(=O)N[C@@H](Cc1ccccc1)C(=O)[O-])c1ccco1 |
| InChI | InChI=1S/C21H18N2O5/c24-19(23-17(21(26)27)13-14-7-2-1-3-8-14)15-9-4-5-10-16(15)22-20(25)18-11-6-12-28-18/h1-12,17H,13H2,(H,22,25)(H,23,24)(H,26,27)/p-1/t17-/m0/s1 |
| InChIKey | UCRLHEGXDVZBKA-KRWDZBQOSA-M |
| XLogP | 1.62 |
| TPSA | 111.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.38 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |