C23H19N3O5 — CID 4527842
2-[[2-(furan-2-carbonylamino)benzoyl]amino]-3-(1H-indol-2-yl)propanoic acid (PubChem CID 4527842) has the molecular formula C23H19N3O5 and a molecular weight of 417.42 g/mol. Its IUPAC name is 2-[[2-(furan-2-carbonylamino)benzoyl]amino]-3-(1H-indol-2-yl)propanoic acid.
| Compound Name | 2-[[2-(furan-2-carbonylamino)benzoyl]amino]-3-(1H-indol-2-yl)propanoic acid |
|---|---|
| PubChem CID | 4527842 |
| Molecular Formula | C23H19N3O5 |
| Molecular Weight | 417.42 g/mol |
| Exact Mass | 417.13 |
| IUPAC Name | 2-[[2-(furan-2-carbonylamino)benzoyl]amino]-3-(1H-indol-2-yl)propanoic acid |
| SMILES | O=C(Nc1ccccc1C(=O)NC(Cc1cc2ccccc2[nH]1)C(=O)O)c1ccco1 |
| InChI | InChI=1S/C23H19N3O5/c27-21(16-7-2-4-9-18(16)25-22(28)20-10-5-11-31-20)26-19(23(29)30)13-15-12-14-6-1-3-8-17(14)24-15/h1-12,19,24H,13H2,(H,25,28)(H,26,27)(H,29,30) |
| InChIKey | PHUDFJGAYHVUQF-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 124.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.42 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |