C31H27N3O5 — CID 11827463
3-phenyl-2-[[2-[[2-[(2-phenylacetyl)amino]benzoyl]amino]benzoyl]amino]propanoic acid (PubChem CID 11827463) has the molecular formula C31H27N3O5 and a molecular weight of 521.57 g/mol. Its IUPAC name is 3-phenyl-2-[[2-[[2-[(2-phenylacetyl)amino]benzoyl]amino]benzoyl]amino]propanoic acid.
| Compound Name | 3-phenyl-2-[[2-[[2-[(2-phenylacetyl)amino]benzoyl]amino]benzoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 11827463 |
| Molecular Formula | C31H27N3O5 |
| Molecular Weight | 521.57 g/mol |
| Exact Mass | 521.20 |
| IUPAC Name | 3-phenyl-2-[[2-[[2-[(2-phenylacetyl)amino]benzoyl]amino]benzoyl]amino]propanoic acid |
| SMILES | O=C(Cc1ccccc1)Nc1ccccc1C(=O)Nc1ccccc1C(=O)NC(Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C31H27N3O5/c35-28(20-22-13-5-2-6-14-22)32-25-17-9-7-15-23(25)29(36)33-26-18-10-8-16-24(26)30(37)34-27(31(38)39)19-21-11-3-1-4-12-21/h1-18,27H,19-20H2,(H,32,35)(H,33,36)(H,34,37)(H,38,39) |
| InChIKey | UICUTSYMTMBOEO-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 124.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.57 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |